Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
18138-04-0 |
EC NO: |
242-024-6 |
Molecular Formula: |
C9H14N2 |
Molecular Weight: |
150.2209 |
Specification: |
|
InChI: |
InChI=1/C9H14N2/c1-4-8-9(5-2)11-7(3)6-10-8/h6H,4-5H2,1-3H3 |
Product description:
;Clear slightly yellow liquid. Roasted, nutty odor.;Remove from exposure to fresh air immediately. If not breathing, give artificial respiration. If breathing is difficult, give oxygen. Get medical aid if cough or other symptoms appear. ; |
Synonyms: |
2,3-Diethyl-5-methylpyrazine;pyrazine, 2,3-diethyl-5-methyl-;2,3-Diethyl-5-methyl pyrazine; |
Molecular Structure: |
 |